On Target OPRX_HUMAN 0.07339449/CHEMBL3144468
For the given ligand CN(C)C(=N)/N=C(N)/N, we have found in our database that, being scored 0.07339449, the most similar ligand is CHEMBL3144468. Check out the elaboration below.
| CN(C)C(=N)/N=C(N)/N (Given Ligand) | CHEMBL3144468 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | CC(=O)N[C@@H](CCCNC(N)=O)C(=O)N[C@H](CC1CCCCC1)C(=O)N[C@H]1CC[C@H]2CCC[C@@H](C(=O)N[C@H](CCCN=C(N)N)C(=O)N[C@H](Cc3ccc(Cl)cc3)C(N)=O)N2C1=O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 00018000 01003200 00100100 04010e00 00000002 00000000 00010000 2000200c 00200880 000808c2 08300010 5003b800 0600903e 00002009 80000000 00000000 00000800 02000000 02002008 00000201 00000100 38250730 00000003 83500018 00002800 80000000 40050000 10000000 0c000000 0006000b 200a4000 00022600 |