On Target GRM4_HUMAN 0.04137931/CHEMBL2023626
For the given ligand CN(C)C(=N)/N=C(N)/N, we have found in our database that, being scored 0.04137931, the most similar ligand is CHEMBL2023626. Check out the elaboration below.
| CN(C)C(=N)/N=C(N)/N (Given Ligand) | CHEMBL2023626 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | O=C(Oc1ccc2c(-c3cnn(-c4ccccc4)c3)ccnc2c1)N1CCOCC1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 00000006 40004a08 60004188 80010e10 200c1080 00024008 06000000 00001008 04000300 000108c0 01200004 60008000 80008802 00400000 01031049 801e010c 10020040 82400004 04680100 01261200 40000040 18038c38 32800800 83402018 00000401 80010022 00800800 00000040 04004280 10460009 c0040000 b02006a0 |