On Target HRH1_HUMAN 0.09/CHEMBL273170
For the given ligand CN(C)C(=N)/N=C(N)/N, we have found in our database that, being scored 0.09, the most similar ligand is CHEMBL273170. Check out the elaboration below.
| CN(C)C(=N)/N=C(N)/N (Given Ligand) | CHEMBL273170 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | CC1NC(N)=Nc2ccc(Cl)c(Cl)c21 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 00008042 0c000000 00000100 00010e00 00000000 00100000 0c000000 02003000 00000000 0008885a 19200004 44008820 02001804 40000009 800200c0 00100018 04000800 02000004 01000000 00000000 40000c00 08018100 22000010 00400010 00282000 88100200 40080000 90000a20 00000110 00860002 08040020 e0020700 |