On Target 5HT7R_HUMAN 0.13636364/CHEMBL3770342
For the given ligand CN(C)C(=N)/N=C(N)/N, we have found in our database that, being scored 0.13636364, the most similar ligand is CHEMBL3770342. Check out the elaboration below.
| CN(C)C(=N)/N=C(N)/N (Given Ligand) | CHEMBL3770342 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | NC1=NC2(CCCCC2)NC(Nc2cccc(Br)c2)=N1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 00004046 01008010 00100000 00000e00 62000400 00080000 00810004 01002001 c0000200 000008c2 10202035 40018000 00001010 00000008 00001040 00300000 10060801 00400001 0a002000 00010001 40122104 38030810 30030001 02100210 10510010 00010000 40030000 10007080 08209090 00060000 80080009 0c004200 |