On Target 5HT4R_HUMAN 0.06923077/CHEMBL2058702
For the given ligand CN(C)C(=N)/N=C(N)/N, we have found in our database that, being scored 0.06923077, the most similar ligand is CHEMBL2058702. Check out the elaboration below.
| CN(C)C(=N)/N=C(N)/N (Given Ligand) | CHEMBL2058702 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | C/N=C1\NC(=O)/C(=C/c2c[nH]c3ccccc23)N1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 00400042 00008800 00800100 02010e10 00041044 00202008 808000c0 00002400 01802440 01406842 10200204 4000a001 04018800 00410008 00000042 80540084 20000c00 12006100 10278004 10800003 40010100 2a018608 20800000 80400011 00040000 80000001 48402008 40050100 08400010 00060081 04044240 00002220 |