On Target CXCR3_HUMAN 0.54545456/CHEMBL252503
For the given ligand Fentanyl, we have found in our database that, being scored 0.54545456, the most similar ligand is CHEMBL252503. Check out the elaboration below.
| Fentanyl (Given Ligand) | CHEMBL252503 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3 | CC(C)(C)C(=O)N1CCC(CN2CCC(CC2)NC(=O)Nc3cc(cc(c3)C(F)(F)F)C(F)(F)F)CC1 |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 00000006 01081400 00100100 00010e00 04000001 00000000 00000404 20002001 00200000 000009f0 00280004 50039006 00009002 09100000 00000040 00000008 00040000 02400000 08000000 00000211 40000100 180d0600 20022000 00500018 00150000 80000000 00000000 90000080 00408000 00060011 00100000 00006200 |