On Target ADRB3_HUMAN 0.06315789/CHEMBL101591
For the given ligand ACTE, we have found in our database that, being scored 0.06315789, the most similar ligand is CHEMBL101591. Check out the elaboration below.
| ACTE (Given Ligand) | CHEMBL101591 (Similar Ligand) |
|---|---|
| C1CCCCCCC1 | CCCCCC(Cc1ccccc1)NCC(O)c2ccc(O)c(NS(=O)(=O)C)c2 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 | 00000002 01000008 20100102 00310600 00000080 00004000 02000000 20000000 00400980 000808c0 08302004 40018000 00000402 00201001 80081040 000a4028 10080000 0a000000 00002000 80024201 40000100 18200830 22000000 81500010 00040080 80000000 00520000 1000000c 04400002 0006000a 40020000 00012660 |