On Target 5HT5A_HUMAN 0.071428575/CHEMBL191460
For the given ligand ACTE, we have found in our database that, being scored 0.071428575, the most similar ligand is CHEMBL191460. Check out the elaboration below.
| ACTE (Given Ligand) | CHEMBL191460 (Similar Ligand) |
|---|---|
| C1CCCCCCC1 | CN(C)CCN(Cc1ccc(cc1)c2ccc(CNCCc3ccccc3)cc2)C(=O)CCC4CCCC4.OC(=O)C(F)(F)F.OC(=O)C(F)(F)F |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 | 00012000 01802000 00100100 04010600 00000000 00000000 00000000 22001008 00000180 000908c0 08200000 40019000 8400880a 00002000 00000400 00080008 00020000 02000000 04002000 10000205 80000000 38208e10 10000001 83500018 00000000 c0000000 00000000 90000040 0c004100 01060003 20060000 00000600 |