On Target 5HT1F_HUMAN 0.048/CHEMBL101686
For the given ligand ACTE, we have found in our database that, being scored 0.048, the most similar ligand is CHEMBL101686. Check out the elaboration below.
| ACTE (Given Ligand) | CHEMBL101686 (Similar Ligand) |
|---|---|
| C1CCCCCCC1 | CCCCCCCC(=O)Nc1ccc2[nH]cc(C3CCN(C)CC3)c2n1 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 | 00014002 01800a00 00184180 40810610 200c1240 00002000 0000a000 20100000 00400800 200800c0 08380004 5001b000 0c00880a 00500800 00060840 00040004 08040000 02004008 08602400 00a00205 40100100 5c008618 21802840 80700010 00042000 80000000 08008080 10000084 00008008 0006180b 00061200 00000720 |