On Target ADRB1_HUMAN 0.071428575/CHEMBL236514
For the given ligand ACTE, we have found in our database that, being scored 0.071428575, the most similar ligand is CHEMBL236514. Check out the elaboration below.
| ACTE (Given Ligand) | CHEMBL236514 (Similar Ligand) |
|---|---|
| C1CCCCCCC1 | O[C@@H](CNC12CC3CC(CC(C3)C1)C2)COc4cccc5[nH]ccc45 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 | 04000002 01000008 20100108 00010600 00041080 02000000 06080000 20000008 00000000 000008c0 00200004 40018000 00800806 00400000 01280041 000c200c 10200000 00000004 02a02000 00060201 40000000 18008018 27800080 88100010 00002001 00000000 00000000 10800000 00000200 00060000 00060200 00202240 |