On Target 5HT1E_HUMAN 0.046511628/CHEMBL22744
For the given ligand ACTE, we have found in our database that, being scored 0.046511628, the most similar ligand is CHEMBL22744. Check out the elaboration below.
| ACTE (Given Ligand) | CHEMBL22744 (Similar Ligand) |
|---|---|
| C1CCCCCCC1 | NC(=O)c1ccc2[nH]cc(C3=CCC(CC3)NCCCCCCCNC4CCC(=CC4)c5c[nH]c6ccc(cc56)C(=O)N)c2c1 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 | 00000002 09008800 00100302 42810610 00041104 00000000 80082080 20001402 10500900 001828c8 08300004 41018800 88028802 00600800 00000442 00440004 00004400 02000064 00222400 00000203 41000100 1a068618 20808020 80500014 01042000 80000000 88406040 d0000000 04400002 00060c02 84060200 00002620 |