On Target GRM1_HUMAN 0.11320755/CHEMBL1270719
For the given ligand ACTE, we have found in our database that, being scored 0.11320755, the most similar ligand is CHEMBL1270719. Check out the elaboration below.
| ACTE (Given Ligand) | CHEMBL1270719 (Similar Ligand) |
|---|---|
| C1CCCCCCC1 | NCCCNCCCCNCCCNC(=O)[C@H](CC1CCCCC1)NC(=O)C2CCCCC2 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 | 00010000 01003400 00100000 04000400 00000000 00000000 00000000 20000008 00200000 000001a0 00200000 40033000 0600800a 00002000 80000000 00000000 00000000 00000000 02002000 00000201 00000000 300c0610 00000001 02100018 00000000 00000000 00000000 10000000 08000000 00040011 20024000 00002200 |