On Target GRM2_HUMAN 0.1875/CHEMBL482081
For the given ligand ACTE, we have found in our database that, being scored 0.1875, the most similar ligand is CHEMBL482081. Check out the elaboration below.
| ACTE (Given Ligand) | CHEMBL482081 (Similar Ligand) |
|---|---|
| C1CCCCCCC1 | N[C@@H](C[C@@H](CCC(=O)O)C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 | 00030000 01000000 00000000 00000400 00180000 00000000 00000000 00000000 00000000 00020080 00000000 40013000 04008028 02800000 00000000 00080008 00000000 00000000 00402000 00000001 00000000 10000a10 03000000 00000010 00000000 00000000 00000000 00000000 00000000 00040000 00020000 00000000 |