On Target OPRD_HUMAN 0.11764706/CHEMBL330291
For the given ligand ACTE, we have found in our database that, being scored 0.11764706, the most similar ligand is CHEMBL330291. Check out the elaboration below.
| ACTE (Given Ligand) | CHEMBL330291 (Similar Ligand) |
|---|---|
| C1CCCCCCC1 | CN1C[C@@H]2CN(c3ccccc3)C4(CCN(CC4)C5CCCCCCCC5)[C@@H]2C1 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 | 00004002 01000400 00100000 00000600 20000000 00002010 00000000 20000000 00200000 000009e0 00200004 50038000 00000002 00000000 00020040 00000000 00040000 00000000 08002000 00000201 60100000 18000030 20000000 00100010 00000000 00000000 00000000 10000080 00008000 00060010 00020000 00002200 |