On Target BKRB2_HUMAN 0.0952381/CHEMBL109172
For the given ligand ACTE, we have found in our database that, being scored 0.0952381, the most similar ligand is CHEMBL109172. Check out the elaboration below.
| ACTE (Given Ligand) | CHEMBL109172 (Similar Ligand) |
|---|---|
| C1CCCCCCC1 | CN1CCC2(CC1)N(CC3CCCCC3)CN(CC(=O)C)C2=O |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 | 00030000 01001400 00100000 04000c00 00000000 00000000 00000004 20002000 00200000 000001a0 00200000 50033000 06009002 00002001 80000000 00000000 00000000 00002000 02002040 00000201 00000100 30010610 00000001 02100018 00010000 00000000 00000000 10000000 08000000 00040011 201a4000 00802200 |