On Target 5HT4R_HUMAN 0.0625/CHEMBL80015
For the given ligand ACTE, we have found in our database that, being scored 0.0625, the most similar ligand is CHEMBL80015. Check out the elaboration below.
| ACTE (Given Ligand) | CHEMBL80015 (Similar Ligand) |
|---|---|
| C1CCCCCCC1 | COc1cc(N)c(Cl)cc1C(=O)CCC2CCN(C)CC2 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 | 00018002 85000808 2010010a c0010600 00001000 00020000 06000000 20000200 00000800 000808c0 08300004 50019840 0600800e 08200000 81000041 00002008 00000000 02000400 00002000 00020601 40000100 18020310 20000000 00540414 00002000 c0000400 00100800 10000000 00000302 00064802 80020000 00020600 |