On Target CCR2_HUMAN 0.08450704/CHEMBL523857
For the given ligand ACTE, we have found in our database that, being scored 0.08450704, the most similar ligand is CHEMBL523857. Check out the elaboration below.
| ACTE (Given Ligand) | CHEMBL523857 (Similar Ligand) |
|---|---|
| C1CCCCCCC1 | CC(C)[C@@]1(CC[C@H](C1)NC2CCCC2)C(=O)NCc3cc(cc(c3)C(F)(F)F)C(F)(F)F |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 | 00030000 018a0000 00100100 00010600 00000001 00000000 10000400 22001000 00200000 000008d0 00200000 40039002 0400881a 01000000 00000400 00000008 00000000 02000000 00002000 00000201 80000000 18008630 00000000 00500018 00000000 c0000000 08000000 90000000 00000100 01060001 20160000 00802200 |