On Target 5HT4R_HUMAN 0.047058824/CHEMBL1258560
For the given ligand test, we have found in our database that, being scored 0.047058824, the most similar ligand is CHEMBL1258560. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1258560 (Similar Ligand) |
|---|---|
| CCCCC | CCCN1CCC(COC(=O)c2ccc(N)c(OC)c2)CC1 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000002 49000808 20100108 80090700 80101010 00004000 02000000 20000000 00000100 000008c8 00200004 50018000 00008002 00010000 01004045 22085008 00020000 02000000 00480000 00020201 40000020 18020a20 21000000 00500014 00000400 80002000 00080200 10000000 00000200 00060002 c0000000 02002a00 |