On Target GRM1_HUMAN 0.34615386/CHEMBL92162
For the given ligand cocaine , we have found in our database that, being scored 0.34615386, the most similar ligand is CHEMBL92162. Check out the elaboration below.
| cocaine (Given Ligand) | CHEMBL92162 (Similar Ligand) |
|---|---|
| COC(=O)[C@H]2[C@@H](OC(=O)c1ccccc1)C[C@H]3CC[C@@H]2N3C | N[C@@](CC1c2ccccc2Sc3ccccc13)([C@@H]4C[C@@H](C4)C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00010000 01000800 00100100 00010700 000c0050 00204010 00000000 20000000 00000100 010008c0 00200000 50019000 1c00801a 01890000 00000000 02081008 00a20000 02000000 01c02010 00000201 00000020 18020a30 01000080 00500014 00001401 80002000 00088000 10001000 00000200 0006000e c0020000 02002200 | 00010000 01800200 00020102 00110600 000e0000 00100020 00000000 01004002 00000800 000808c0 08100400 6001b000 0c008018 01a00010 00000000 00080008 04001000 02000004 00602010 00000001 80000100 18000a00 03800000 00400019 00003000 a0000000 00000000 40001000 00000282 0007000a 00020100 00410420 |