On Target NPFF1_HUMAN 0.33103448/CHEMBL1672379
For the given ligand cocaine , we have found in our database that, being scored 0.33103448, the most similar ligand is CHEMBL1672379. Check out the elaboration below.
| cocaine (Given Ligand) | CHEMBL1672379 (Similar Ligand) |
|---|---|
| COC(=O)[C@H]2[C@@H](OC(=O)c1ccccc1)C[C@H]3CC[C@@H]2N3C | CC(C)C[C@H](NC(=O)[C@@H](N)CO)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc2ccccc2)C(=O)O |
|
|
|
|
|
|
| 00010000 01000800 00100100 00010700 000c0050 00204010 00000000 20000000 00000100 010008c0 00200000 50019000 1c00801a 01890000 00000000 02081008 00a20000 02000000 01c02010 00000201 00000020 18020a30 01000080 00500014 00001401 80002000 00088000 10001000 00000200 0006000e c0020000 02002200 | 00030000 01007000 00100100 04010e00 00000080 00000010 00000000 2000200c 00200a80 000a08c2 08300000 4003b000 16009012 00002001 80180000 00180008 10000000 02000000 00c00008 00000201 00000100 38250e20 030000c3 83500018 00000801 80000000 40000000 10000000 0c000010 00060003 a0084000 00802600 |