On Target HRH4_HUMAN 0.5322581/CHEMBL4083336
For the given ligand cocaine , we have found in our database that, being scored 0.5322581, the most similar ligand is CHEMBL4083336. Check out the elaboration below.
| cocaine (Given Ligand) | CHEMBL4083336 (Similar Ligand) |
|---|---|
| COC(=O)[C@H]2[C@@H](OC(=O)c1ccccc1)C[C@H]3CC[C@@H]2N3C | O=C(CCNC(=O)C(Cc1ccccc1)Cn2ccnc2)OCc3ccccc3 |
|
|
|
|
|
|
| 00010000 01000800 00100100 00010700 000c0050 00204010 00000000 20000000 00000100 010008c0 00200000 50019000 1c00801a 01890000 00000000 02081008 00a20000 02000000 01c02010 00000201 00000020 18020a30 01000080 00500014 00001401 80002000 00088000 10001000 00000200 0006000e c0020000 02002200 | 00000002 00001600 00100100 00010600 000e0050 00104000 00000000 20000000 00300900 000809c0 08308008 40019000 0c009002 018d0000 00000080 020c000c 00320000 02000001 00c00018 00000201 80000120 18100e30 21000080 00400018 00001c01 80002000 00080000 10000000 00000200 0046001b 40080000 02002600 |