On Target ACM4_HUMAN 0.24193548/CHEMBL2377384
For the given ligand test, we have found in our database that, being scored 0.24193548, the most similar ligand is CHEMBL2377384. Check out the elaboration below.
| test (Given Ligand) | CHEMBL2377384 (Similar Ligand) |
|---|---|
| c3ccc(c1ccccc1c2ccccc2)cc3 | [Br-].C[N+](C)(C)CCOC(=O)C(c1ccccc1)c2ccccc2 |
|
|
|
|
|
|
| 00002000 00000001 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000080 40008000 00000000 00200000 20000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 00000000 00000000 00000300 80010600 000000c0 00000000 00000000 01000040 00000000 00080840 08200000 40009000 01008000 00000000 40041008 00080008 08060000 02000000 04000000 00000000 00010020 08000a00 13000000 00400010 10000400 a0000000 00000000 40000000 00000280 00060002 00002008 00000600 |