On Target CLTR1_HUMAN 0.14285715/CHEMBL33329
For the given ligand test, we have found in our database that, being scored 0.14285715, the most similar ligand is CHEMBL33329. Check out the elaboration below.
| test (Given Ligand) | CHEMBL33329 (Similar Ligand) |
|---|---|
| c3ccc(c1ccccc1c2ccccc2)cc3 | OC(=O)c1ccc2OC(=CC(=O)c2c1)c3cccc(\C=C\c4ccc5ccccc5n4)c3 |
|
|
|
|
|
|
| 00002000 00000001 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000080 40008000 00000000 00200000 20000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 00402002 00200800 00084100 10050e00 00040221 82004020 80000080 48800608 02004100 40000840 00000134 40008000 40008c00 006000c8 80020062 020c020c 00064400 02001800 06200200 00000000 40240000 1a068a28 30884000 80590004 08000040 82000005 04402074 48100241 00406004 01a60000 c4040040 00000000 |