On Target GRM3_HUMAN 0.203125/CHEMBL2112584
For the given ligand test, we have found in our database that, being scored 0.203125, the most similar ligand is CHEMBL2112584. Check out the elaboration below.
| test (Given Ligand) | CHEMBL2112584 (Similar Ligand) |
|---|---|
| c3ccc(c1ccccc1c2ccccc2)cc3 | NC(CCCc1ccccc1)([C@H]2C[C@@H]2C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00002000 00000001 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000080 40008000 00000000 00200000 20000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 00030000 01000000 00000102 00010600 00180000 00000000 00000000 00000000 00100800 000a08c0 08100000 4001b000 04008038 03a00000 00000000 00080008 00000000 02000000 00402000 00000001 00000100 18000a00 03000000 00400010 00000000 80000000 00000000 00000000 00000002 00060002 00020000 00000400 |