On Target GRM2_HUMAN 0.23863636/CHEMBL3974279
For the given ligand test, we have found in our database that, being scored 0.23863636, the most similar ligand is CHEMBL3974279. Check out the elaboration below.
| test (Given Ligand) | CHEMBL3974279 (Similar Ligand) |
|---|---|
| c3ccc(c1ccccc1c2ccccc2)cc3 | Cc1cc(Cl)ccc1c2cc(nc3ccccc23)C(=O)N |
|
|
|
|
|
|
| 00002000 00000001 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000080 40008000 00000000 00200000 20000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 0000a002 00000801 00004100 10010600 00040020 04010000 04000000 00001001 00000000 00000840 00090004 60008800 82008804 00708000 a0020040 0a04200c 00020000 02001000 04200000 00000000 40000000 08028708 30802000 8040000c 00102000 80000000 08040040 00000041 10004004 00060001 80040000 01024020 |