On Target OPRD_HUMAN 0.22105263/CHEMBL3809491
For the given ligand test, we have found in our database that, being scored 0.22105263, the most similar ligand is CHEMBL3809491. Check out the elaboration below.
| test (Given Ligand) | CHEMBL3809491 (Similar Ligand) |
|---|---|
| c3ccc(c1ccccc1c2ccccc2)cc3 | CN(C)C[C@H]1CCc2cc(ccc2[C@]1(O)c3cccc(O)c3)c4ccccc4C |
|
|
|
|
|
|
| 00002000 00000001 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000080 40008000 00000000 00200000 20000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 00002000 4b000209 20100102 00050600 00080001 40004002 02000400 01000001 00100900 000808c0 08300000 40018800 00000002 00200000 20000020 020c2008 00020200 02001000 04d02000 10020201 00000500 18000020 11004080 00520010 00000000 a0000281 00000000 50000041 02004082 0006000a 40000000 00000600 |