On Target AA2BR_HUMAN 0.20930232/CHEMBL376778
For the given ligand cocaine, we have found in our database that, being scored 0.20930232, the most similar ligand is CHEMBL376778. Check out the elaboration below.
| cocaine (Given Ligand) | CHEMBL376778 (Similar Ligand) |
|---|---|
| c2ccc(c1ccccc1)cc2 | CC(C)C(=O)Nc1nc(-c2ccccc2)cc(-c2ccccc2)n1 |
|
|
|
|
|
|
| 00002000 00000000 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 40008000 00000000 00000000 00000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 0000a002 00000800 80180100 00050600 01000004 00004000 00002000 00180000 00000100 20000840 00302004 60009800 02808000 00100000 00020000 000c000c 00020000 02007000 04400000 00a00000 00000000 1c022600 30802840 00400118 00000000 81000000 00000000 00000061 0000400c 00460801 40001800 000003a0 |