On Target CCR5_HUMAN 0.22222222/CHEMBL106264
For the given ligand cocaine, we have found in our database that, being scored 0.22222222, the most similar ligand is CHEMBL106264. Check out the elaboration below.
| cocaine (Given Ligand) | CHEMBL106264 (Similar Ligand) |
|---|---|
| c2ccc(c1ccccc1)cc2 | Cc1cccc(C)c1C(=O)N1CCC(C)(N2CCC(Cc3ccc(-c4ccccc4)cc3)CC2)CC1 |
|
|
|
|
|
|
| 00002000 00000000 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 40008000 00000000 00000000 00000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 00002000 01001c00 00100102 10010600 00000001 00008000 00000000 22001000 00100900 000809e0 08300000 50018800 00008802 00200000 00000400 00000008 00020000 02000000 04000000 10000201 00020100 180e8600 10000000 0050001c 00000000 c0000000 00004000 90000040 00004100 00060013 a0040000 00002600 |