On Target HRH4_HUMAN 0.2535211/CHEMBL4100315
For the given ligand cocaine, we have found in our database that, being scored 0.2535211, the most similar ligand is CHEMBL4100315. Check out the elaboration below.
| cocaine (Given Ligand) | CHEMBL4100315 (Similar Ligand) |
|---|---|
| c2ccc(c1ccccc1)cc2 | c1ccc(-c2ccc(CCCOCCCc3c[nH]cn3)cc2)cc1 |
|
|
|
|
|
|
| 00002000 00000000 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 40008000 00000000 00000000 00000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 00002042 00000008 00000100 00810310 04000040 00000000 00002000 00000000 00400900 00080840 28108000 40018800 00000000 00100800 00020000 000c100c 00020000 06000000 04400008 50000001 00000520 08000000 310000c0 00400010 00040401 82000200 00000000 00000040 00004204 00420002 40000000 20000400 |