On Target CCR1_HUMAN 0.09677419/CHEMBL33761
For the given ligand 633, we have found in our database that, being scored 0.09677419, the most similar ligand is CHEMBL33761. Check out the elaboration below.
| 633 (Given Ligand) | CHEMBL33761 (Similar Ligand) |
|---|---|
| c1ccccc1 | C[N+]1(CC2CCCCCCC2)CCC(NC(=O)C(c2ccccc2)c2ccccc2)CC1.[I-] |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 00000000 | 00000000 01001400 00100100 00010600 00000000 00000000 00000000 21000000 00000080 000809e0 08200000 50019000 01008002 00000000 40000000 00000000 00000000 02000000 00002000 00000201 00000000 18280610 00000000 81500018 00000000 a0000000 00000000 50000000 04000080 00060013 00222000 00002600 |