On Target AA1R_HUMAN 0.115384616/CHEMBL372580
For the given ligand 633, we have found in our database that, being scored 0.115384616, the most similar ligand is CHEMBL372580. Check out the elaboration below.
| 633 (Given Ligand) | CHEMBL372580 (Similar Ligand) |
|---|---|
| c1ccccc1 | CCc1nc2c([nH]1)c1nc(C)[nH]c1c1nc(CC)[nH]c12 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 00000000 | 0000000a 00800000 00000400 10000200 000c0060 0000c000 00009000 00000000 10400100 00000840 01008004 40808000 00000000 00c00000 00020040 020c0004 00000000 00000000 00600000 00000000 40000000 08000060 21800040 00000010 00000000 00000000 00000000 00000000 00000004 00420800 40000000 20000480 |