On Target CNR1_HUMAN 0.13043478/CHEMBL3809355
For the given ligand 633, we have found in our database that, being scored 0.13043478, the most similar ligand is CHEMBL3809355. Check out the elaboration below.
| 633 (Given Ligand) | CHEMBL3809355 (Similar Ligand) |
|---|---|
| c1ccccc1 | CCCCCCC(C)(C)c1cc(O)c(C2CCCCC2)c(O)c1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 00000000 | 00000001 43000008 20000102 00010200 00000000 40000000 02000000 00000200 00000900 00080840 08100000 40008840 00000002 00200000 00000000 00002008 00000000 02000000 02002000 00020a01 00000100 08000000 00000000 00400010 00000000 80000000 00000000 00000000 00000002 00024002 00020000 00000400 |