On Target GRM1_HUMAN 0.0882353/CHEMBL254372
For the given ligand 633, we have found in our database that, being scored 0.0882353, the most similar ligand is CHEMBL254372. Check out the elaboration below.
| 633 (Given Ligand) | CHEMBL254372 (Similar Ligand) |
|---|---|
| c1ccccc1 | C=C1C[C@@H]2COC(=O)[C@]2(Cc2ccc3ccccc3c2)C1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 00000000 | 00050040 81000008 00000102 80010300 00080000 00000000 00000000 00000400 00000800 00188848 08100000 40009000 04008008 00a00000 00080400 00081008 00820000 02000000 00402008 00000001 00000120 08000a08 01000040 00400010 00000c00 80002000 00000000 80000000 00000202 81020002 24020000 00000400 |