On Target CXCR1_HUMAN 0.10344828/CHEMBL184637
For the given ligand 633, we have found in our database that, being scored 0.10344828, the most similar ligand is CHEMBL184637. Check out the elaboration below.
| 633 (Given Ligand) | CHEMBL184637 (Similar Ligand) |
|---|---|
| c1ccccc1 | O=C(Nc1ccc(O)cc1O)Nc1ccccc1Br |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 00000000 | 00004007 04008008 20000000 00000a40 00000000 00000000 02000000 00002001 00020000 00000840 00280004 00008000 00008032 00100000 80000040 00004008 00040000 08000000 08000000 00020801 40000100 08000400 20022000 00090000 00100000 00000000 20060040 00000080 00008000 00060001 00000008 08004000 |