On Target CNR2_HUMAN 0.16216215/CHEMBL408777
For the given ligand 633, we have found in our database that, being scored 0.16216215, the most similar ligand is CHEMBL408777. Check out the elaboration below.
| 633 (Given Ligand) | CHEMBL408777 (Similar Ligand) |
|---|---|
| c1ccccc1 | CCCCCCC(C)(C)c1ccc([C@@H]2C[C@H](O)CC[C@H]2CCCO)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 00000000 | 00000000 01000000 00000102 00010200 00080000 00000000 00000000 00000000 00000900 00080840 08100000 40008800 00000000 00a00000 00000000 00080008 00000000 02000000 02402000 00000001 00000100 08000000 01000040 00400010 00000000 80000000 00000000 00000000 00000002 00020002 00020000 00000400 |