On Target ACM5_HUMAN 0.43801653/CHEMBL1090094
For the given ligand CAR, we have found in our database that, being scored 0.43801653, the most similar ligand is CHEMBL1090094. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL1090094 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | CCN1CCN(c2ccc(NC(=O)c3c(F)c(F)c(F)c(F)c3F)cc2Cl)CC1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0000c002 00001800 00100120 07010600 00000000 00000010 08000000 0a001000 00000000 00012a40 00280004 d000c800 02008846 00103001 00200060 00000000 02041200 12000100 08000000 04904000 40100000 28068700 20012020 22410006 00002000 80000401 00000000 80000081 08008100 00068001 80040000 00020200 |