On Target CCR4_HUMAN 0.38311687/CHEMBL600805
For the given ligand CAR, we have found in our database that, being scored 0.38311687, the most similar ligand is CHEMBL600805. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL600805 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | CCCCCCCNC(=O)N1CCN(c2c(C)c3c(O)cc(O)cc3oc2=O)CC1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 00004003 41203008 20180120 04410e00 00050216 00400060 02000004 40002208 020a4000 40020ac0 04200044 4061a000 4000b422 00202480 000200c0 00000088 00240010 42000040 08802040 00821a03 40104100 38050418 20000028 0258001a 08010000 80000000 00040030 18101080 0a00a000 09060801 008a0000 00000200 |