On Target 5HT1D_HUMAN 0.72164947/CHEMBL1085672
For the given ligand CAR, we have found in our database that, being scored 0.72164947, the most similar ligand is CHEMBL1085672. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL1085672 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | O=C1N(CC2CCCCN2)CCN1c1cccc(Cl)c1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0000c006 01003000 00100020 07000e00 00000000 00000000 08000004 20002009 00000000 00020ac0 00280004 50018800 0200b006 00102001 00000040 00000000 00040010 00402000 08002040 00004201 40100100 38050510 20022003 0210001a 00112000 00000000 00000000 10000080 08008000 00060001 00080000 00024200 |