On Target GASR_HUMAN 0.5483871/CHEMBL317108
For the given ligand CAR, we have found in our database that, being scored 0.5483871, the most similar ligand is CHEMBL317108. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL317108 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | O=C(Nc1cccc(Cl)c1)NC1C(=O)N(CC23CC4CC(CC(C4)C2)C3)c2ccccc2N(C2CCCCC2)C1=O |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0001c006 01003400 00100021 06000e00 20000000 00002000 08000004 20302009 00000100 00020be0 00282004 5001b800 0e00a006 00102001 00060040 00000000 00040010 00404000 0a002010 00004201 60100100 38050710 20022001 0210001a 00103000 00000000 00000020 10008080 08008000 02060011 20025000 00026200 |