On Target HRH2_HUMAN 0.36805555/CHEMBL4562437
For the given ligand CAR, we have found in our database that, being scored 0.36805555, the most similar ligand is CHEMBL4562437. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL4562437 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | Cc1cccc(C)c1N1C(=O)[C@H](CC2CNc3ccccc32)NC2(CCN(C)CC2)C1=O |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 00034002 01003600 00100122 04010600 20000001 00002040 03000000 20000008 00300800 00080be0 08382004 5003b000 06008012 00302001 80020140 0004000a 00248000 02000000 08000008 00000201 40120100 38240620 20002021 8350001b 00000000 80000000 00000010 10001080 0c008000 0006001b 00004080 20c02600 |