On Target NPSR1_HUMAN 0.31944445/CHEMBL1210177
For the given ligand CAR, we have found in our database that, being scored 0.31944445, the most similar ligand is CHEMBL1210177. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL1210177 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | CN1CCN(C2(CN(Cc3cc4ccccc4n(C)c3=O)C(=O)C3CCCCC3)CCCCC2)CC1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 10010002 0180f000 00104100 04010610 00041002 00004060 00004000 22001008 06000001 400108e0 05200004 40019000 0400980a 00602000 00100440 00040004 00020000 82000004 02202000 00000201 c0000000 38048e18 20800023 82700018 00040000 c0000000 08800000 90000000 08400100 00060041 20060000 80002200 |