On Target NK2R_HUMAN 0.4452555/CHEMBL3651891
For the given ligand CAR, we have found in our database that, being scored 0.4452555, the most similar ligand is CHEMBL3651891. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL3651891 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | CC(=O)N1CCC(C(=O)N2C[C@@H](N(C)C(=O)N(C)c3cc(Cl)cc(Cl)c3)[C@H](c3ccc(F)cc3)C2)CC1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 00028006 01003600 00100100 06010e00 00000000 00000030 08000004 2000200d 00200880 000a09e0 08380004 50039800 0600b006 00103401 00000040 00040000 00040018 02400080 08000000 00104201 40000100 382d0700 20022001 83500018 00112000 80000000 00000000 10000081 0c008000 0006801b 00100000 00826600 |