On Target ACM1_HUMAN 0.7078652/CHEMBL256202
For the given ligand CAR, we have found in our database that, being scored 0.7078652, the most similar ligand is CHEMBL256202. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL256202 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | CCCCCC(=O)Nc1ccc(N2CCN(CC)CC2)c(Cl)c1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0001c002 01001000 00100020 05000600 20000000 00002000 08000000 08000000 00000000 00000ac0 00280004 40019800 0600800e 00102001 00020040 00000000 00040000 10000000 08002000 00004001 40100000 38040710 20002020 02110012 00002000 00000400 00000000 10000080 08008000 00060001 00000000 00020200 |