On Target CNR1_HUMAN 0.5925926/CHEMBL3799603
For the given ligand CAR, we have found in our database that, being scored 0.5925926, the most similar ligand is CHEMBL3799603. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL3799603 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | O=C(NCCCCN1CCN(c2cccc(Cl)c2Cl)CC1)Oc1ccccc1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0000c002 00001008 60100028 05000600 00001000 00008000 0a000000 28000000 04200200 00000ac0 00200004 40028800 02008006 00002001 01010041 00120008 00060000 10080000 08000000 00024201 40100000 38040d50 30000021 0201201a 00002000 00110422 00000000 10000080 08008200 00060001 80000000 10020200 |