On Target PTAFR_HUMAN 0.2857143/CHEMBL345902
For the given ligand CAR, we have found in our database that, being scored 0.2857143, the most similar ligand is CHEMBL345902. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL345902 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | Cc1nc2ccccc2n1Cc1ccc(C(=O)N(C)C2CCCCC2)cc1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 00000002 01801a00 00100100 50010600 000c0060 00004000 00000000 22001000 80100100 000018c0 0120800c 40018000 80009802 00400000 000204c0 020c0004 00000000 02000000 02682000 00000201 c0000000 18068630 21800041 8150001c 00000000 c0000000 00000000 90000000 04000104 00460809 e00c0000 00000680 |