On Target 5HT1F_HUMAN 0.36805555/CHEMBL186951
For the given ligand CAR, we have found in our database that, being scored 0.36805555, the most similar ligand is CHEMBL186951. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL186951 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | CN1CCC(N2CNc3ccc(NC(=O)c4ccc(F)cc4Cl)cc32)CC1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0000c006 03001c00 00100101 02010e40 28000000 00000010 20000804 02103001 00000000 000009e0 00282004 5001c800 02009806 00101004 01260040 00000000 00040000 03404100 08000000 00100201 60100900 18078700 20032000 00500014 00192000 80300200 00000400 90000081 00808100 00068011 88141000 00024200 |