On Target GRM5_HUMAN 0.45794392/CHEMBL1688366
For the given ligand CAR, we have found in our database that, being scored 0.45794392, the most similar ligand is CHEMBL1688366. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL1688366 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | O=C(N1CCN(c2ccccn2)CC1)C12CC3CC(CC(C3)C1)C2 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 00014002 01002000 00104020 04000600 00040000 00000000 00000000 20000008 00000000 200002c0 00200004 40011000 0400880a 00002000 00000000 00140004 00040000 00004000 0a202000 00a00201 40100000 3e008610 20800821 0230001a 00000000 00000000 00000080 10000080 08008018 00060801 00021000 00000200 |