On Target NPBW1_HUMAN 0.33908045/CHEMBL1940354
For the given ligand CAR, we have found in our database that, being scored 0.33908045, the most similar ligand is CHEMBL1940354. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL1940354 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | COc1ccc([C@@H](C)N[C@@H]2CC[C@H](C(=O)N3CCN(c4ccc(Cl)cn4)CC3)[C@@H](c3ccsc3)C2)cc1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0005c002 01002208 2010492a 85010600 00141000 00000000 02040000 22001008 00000800 20080ac0 08300204 40019880 0600881a 00203001 01001401 0014000c 00040000 02004000 0a202008 00a24601 40100000 7e8087b0 20800821 3270001a 00004800 c4000200 003a0080 90000084 0800831a 0006080b 20069000 02c30e00 |