On Target ADA2A_HUMAN 0.45614034/CHEMBL1221593
For the given ligand CAR, we have found in our database that, being scored 0.45614034, the most similar ligand is CHEMBL1221593. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL1221593 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | COc1ccccc1N1CCN(CCCCCCNC(=O)c2ccc3ccccc3c2)CC1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 00004002 01001808 20100128 04010600 80001000 00000000 02000000 22001000 00000000 00000ac0 00200004 40018000 00008802 00002000 01000441 00004008 00040000 02000000 08002000 00020201 40100000 38068618 20000021 0250801e 00000000 c0000000 20000000 90000080 08008300 00060001 a0040800 00000200 |