On Target GRM3_HUMAN 0.30833334/CHEMBL4447269
For the given ligand CAR, we have found in our database that, being scored 0.30833334, the most similar ligand is CHEMBL4447269. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL4447269 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | CNC(=O)N1CCCC(CN2CCC(OC(c3ccccc3)c3ccccc3)CC2)C1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 00000000 01001400 00100100 00010e00 00000010 00004000 00000004 21002000 00000100 000809e0 08200000 50018000 00009002 00090000 00000000 02080008 00200000 02000000 00800000 00000201 00000120 180d0420 01000080 00500018 00010401 a0002000 00080000 50000000 00000280 00060013 40180000 02002600 |